Boronic acid derivatives
Matrix Scientific 3-AMINOPHENYLBORONIC ACID3--25
3-aminophenylboronic Acid Mf C6h8bno2 Mw 136.95 Cas 30418-59-8 Mdl MFCD00007755
Chemscene ChemScene | 2,4,6-Trimethylphenylboronic acid | 25G | CS-W016097 | 0.98 | 5980-97-2| MFCD00236060 | 164.013
ChemScene | 2,4,6-Trimethylphenylboronic acid | 25G | CS-W016097 | 0.98 | 5980-97-2| MFCD00236060 | 164.013
eMolecules 72824-04-5 | Allylboronic acid pinacol ester | Ambeed | MFCD00013347 | 168.040 | C9H17BO2 | 97.000 | CC1(C)OB(CC=C)OC1(C)C | 1g | 552538916
Allylboronic acid pinacol ester | Ambeed | 72824-04-5 | MFCD00013347 | 168.040 | C9H17BO2 | 97.000 | CC1(C)OB(CC=C)OC1(C)C | 1g | 552538916
Selleck Chemical LLC Canagliflozin hemihydrate
Canagliflozin hemihydrate is the hemihydrate form of canagliflozin which is a SGLT2 inhibitor with IC50 of 2 2 nM for hSGLT2 in a cell-free assay exhibits 413-fold selectivity over hSGLT1
eMolecules 214360-73-3 | 4-Aminobenzeneboronic acid, pinacol ester | Apollo Scientific | MFCD02093721 | 219.090 | C12H18BNO2 | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(N)cc1 | 25g | 600854813
4-Aminobenzeneboronic acid, pinacol ester | Apollo Scientific | 214360-73-3 | MFCD02093721 | 219.090 | C12H18BNO2 | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(N)cc1 | 25g | 600854813
eMolecules 5720-06-9 | ChemScene | 2-Methoxyphenylboronic acid | 10g | 346750459 | CS-W002569 | MFCD00236047 | 151.96 | C7H9BO3
ChemScene | 2-Methoxyphenylboronic acid | 10g | 346750459 | CS-W002569 | 5720-06-9 | MFCD00236047 | 151.960 | C7H9BO3
Cayman Chemical OSU03012, Purity: ≥98%, CAS: 742112-33-0, 5 mg
An analog of celecoxib that inhibits PDK-1 (IC50 = 5 µM), and therefore Akt activation, with no measurable COX-2 inhibition up to 50 µM; inhibits tumor cell growth (IC50s ~ 1.1 µM) across a panel of 60 cancer cell lines and induces apoptosis of chronic lymphocytic leukemia cells independent of bcl-2 overexpression using both caspase-dependent and independent pathways
Chemscene ChemScene | 2-Iodo-3-(trifluoromethyl)pyridine | 250MG | CS-0119782 | 0.96 | 927434-20-6| MFCD12922855 | 273
ChemScene | 2-Iodo-3-(trifluoromethyl)pyridine | 250MG | CS-0119782 | 0.96 | 927434-20-6| MFCD12922855 | 273
eMolecules 1150114-77-4 | Ambeed | 4-Cyano-2-fluorophenylboronic Acid | 250mg | 586032690 | A464605 | MFCD07644472 | 164.93 | C7H5BFNO2
Pharmablock | ethyl 6-methyl-5-nitropyridine-3-carboxylate | 25mg | 551211004 | PB06253 | 1211538-09-8 | MFCD18260802 | 210.189 | C9H10N2O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 54245-33-9 | ChemScene | 3-Bromonaphthalen-2-amine | 100mg | 687355896 | CS-0188356 | MFCD00046482 | 222.085 | C10H8BrN
ChemScene | 3-Bromonaphthalen-2-amine | 100mg | 687355896 | CS-0188356 | 54245-33-9 | MFCD00046482 | 222.085 | C10H8BrN
eMolecules 850568-46-6 | 4-Cyano-2-nitrophenylboronic acid | MFCD04115646 | 1g
Combi-Blocks | 4-Cyano-2-nitrophenylboronic acid | 1g | 117520366 | BB-2046 | 98.000 | 850568-46-6 | MFCD04115646 | 191.940 | C7H5BN2O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 62456-32-0 | 8-Bromonaphthalen-1-ol | MFCD17012355 | 1g
Ambeed | 8-Bromonaphthalen-1-ol | 1g | 531647047 | A127728 | 62456-32-0 | MFCD17012355 | 223.069 | C10H7BrO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 24464-63-9 | n-Decylboronic acid | Combi-Blocks | MFCD01074638 | 186.100 | C10H23BO2 | 95.000 | CCCCCCCCCCB(O)O | 1g | 117525669
n-Decylboronic acid | Combi-Blocks | 24464-63-9 | MFCD01074638 | 186.100 | C10H23BO2 | 95.000 | CCCCCCCCCCB(O)O | 1g | 117525669